C24H26N4O5S — CID 73138996
N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1-phenylmethanesulfonamide (PubChem CID 73138996) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 73138996 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[3-[[4-(4-methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-1-phenylmethanesulfonamide |
| SMILES | COc1ccc(-c2ccnc(NC3COC4C(NS(=O)(=O)Cc5ccccc5)COC34)n2)cc1 |
| InChI | InChI=1S/C24H26N4O5S/c1-31-18-9-7-17(8-10-18)19-11-12-25-24(26-19)27-20-13-32-23-21(14-33-22(20)23)28-34(29,30)15-16-5-3-2-4-6-16/h2-12,20-23,28H,13-15H2,1H3,(H,25,26,27) |
| InChIKey | XZANQSAWLQRRSU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |