C22H22N4O4S — CID 162803732
[(3S,3aS,6S,6aS)-3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate (PubChem CID 162803732) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 162803732 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-[(4-thiophen-2-ylpyrimidin-2-yl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)O[C@H]1CO[C@@H]2[C@@H]1OC[C@@H]2Nc1nccc(-c2cccs2)n1 |
| InChI | InChI=1S/C22H22N4O4S/c27-22(24-11-14-5-2-1-3-6-14)30-17-13-29-19-16(12-28-20(17)19)26-21-23-9-8-15(25-21)18-7-4-10-31-18/h1-10,16-17,19-20H,11-13H2,(H,24,27)(H,23,25,26)/t16-,17-,19-,20+/m0/s1 |
| InChIKey | WVMWMZZNNHXFGQ-QGZVKYPTSA-N |
| XLogP | 3.08 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |