C12H18N2O5 — CID 73132926
N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide (PubChem CID 73132926) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 73132926 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-[6-(2-amino-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclopropanecarboxamide |
| SMILES | NC(=O)COC1COC2C(NC(=O)C3CC3)COC12 |
| InChI | InChI=1S/C12H18N2O5/c13-9(15)5-17-8-4-19-10-7(3-18-11(8)10)14-12(16)6-1-2-6/h6-8,10-11H,1-5H2,(H2,13,15)(H,14,16) |
| InChIKey | DTZJZSUQVXPPOJ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |