C20H32N2O4 — CID 57330631
N-[3-(4-cyclohexylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide (PubChem CID 57330631) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[3-(4-cyclohexylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[3-(4-cyclohexylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 57330631 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | N-[3-(4-cyclohexylbutanoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
| SMILES | O=C(CCCC1CCCCC1)NC1COC2C(NC(=O)C3CC3)COC12 |
| InChI | InChI=1S/C20H32N2O4/c23-17(8-4-7-13-5-2-1-3-6-13)21-15-11-25-19-16(12-26-18(15)19)22-20(24)14-9-10-14/h13-16,18-19H,1-12H2,(H,21,23)(H,22,24) |
| InChIKey | MBMFDAHAJZBWIL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |