C24H39NO4 — CID 162082235
N-[(3S,3aR,6S,6aR)-3-[2-oxo-3-(4-pentylcyclohexyl)propyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide (PubChem CID 162082235) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-3-[2-oxo-3-(4-pentylcyclohexyl)propyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-3-[2-oxo-3-(4-pentylcyclohexyl)propyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 162082235 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-3-[2-oxo-3-(4-pentylcyclohexyl)propyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]cyclopropanecarboxamide |
| SMILES | CCCCCC1CCC(CC(=O)C[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NC(=O)C2CC2)CC1 |
| InChI | InChI=1S/C24H39NO4/c1-2-3-4-5-16-6-8-17(9-7-16)12-20(26)13-19-14-28-23-21(15-29-22(19)23)25-24(27)18-10-11-18/h16-19,21-23H,2-15H2,1H3,(H,25,27)/t16?,17?,19-,21-,22+,23+/m0/s1 |
| InChIKey | ZCMKPNKPDNTALZ-OHIWSIOBSA-N |
| XLogP | 4.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|