C16H27NO3 — CID 70802265
N-[(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-cyclohexylbutanamide (PubChem CID 70802265) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-cyclohexylbutanamide.
| Compound Name | N-[(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-cyclohexylbutanamide |
|---|---|
| PubChem CID | 70802265 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | N-[(3aR,6S,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-cyclohexylbutanamide |
| SMILES | O=C(CCCC1CCCCC1)N[C@H]1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C16H27NO3/c18-15(8-4-7-12-5-2-1-3-6-12)17-13-11-20-14-9-10-19-16(13)14/h12-14,16H,1-11H2,(H,17,18)/t13-,14+,16+/m0/s1 |
| InChIKey | VMPSOIGYXWAZEQ-SQWLQELKSA-N |
| XLogP | 2.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |