C13H15BrO5S — CID 87179116
[(3S,3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzenesulfonate (PubChem CID 87179116) has the molecular formula C13H15BrO5S and a molecular weight of 363.23 g/mol. Its IUPAC name is [(3S,3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87179116 |
| Molecular Formula | C13H15BrO5S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | [(3S,3aR,6S,6aS)-6-bromo-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CO[C@H]3[C@H]2OC[C@@H]3Br)cc1 |
| InChI | InChI=1S/C13H15BrO5S/c1-8-2-4-9(5-3-8)20(15,16)19-11-7-18-12-10(14)6-17-13(11)12/h2-5,10-13H,6-7H2,1H3/t10-,11-,12+,13-/m0/s1 |
| InChIKey | LYUMSFVURGTNGM-RVMXOQNASA-N |
| XLogP | 1.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|