C23H26N6O5 — CID 73132293
N-[6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide (PubChem CID 73132293) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is N-[6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide.
| Compound Name | N-[6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 73132293 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2COC3C2OCC3n2nnnc2Oc2cccc(N(C)C)c2)cc1 |
| InChI | InChI=1S/C23H26N6O5/c1-28(2)15-5-4-6-17(11-15)34-23-25-26-27-29(23)19-13-33-20-18(12-32-21(19)20)24-22(30)14-7-9-16(31-3)10-8-14/h4-11,18-21H,12-13H2,1-3H3,(H,24,30) |
| InChIKey | WAPGLTPXGHGXPS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |