C26H30N6O4 — CID 73134395
4-methoxy-N-[6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzamide (PubChem CID 73134395) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 4-methoxy-N-[6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzamide.
| Compound Name | 4-methoxy-N-[6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzamide |
|---|---|
| PubChem CID | 73134395 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 4-methoxy-N-[6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC2COC3C2OCC3n2nnnc2-c2cccc(CN3CCCC3)c2)cc1 |
| InChI | InChI=1S/C26H30N6O4/c1-34-20-9-7-18(8-10-20)26(33)27-21-15-35-24-22(16-36-23(21)24)32-25(28-29-30-32)19-6-4-5-17(13-19)14-31-11-2-3-12-31/h4-10,13,21-24H,2-3,11-12,14-16H2,1H3,(H,27,33) |
| InChIKey | OZEGCECZORRFCV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |