C25H30N6O4S — CID 11886166
N-[(3S,3aR,6S,6aR)-6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-phenylmethanesulfonamide (PubChem CID 11886166) has the molecular formula C25H30N6O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 11886166 |
| Molecular Formula | C25H30N6O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1-c1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C25H30N6O4S/c32-36(33,17-18-7-2-1-3-8-18)27-21-15-34-24-22(16-35-23(21)24)31-25(26-28-29-31)20-10-6-9-19(13-20)14-30-11-4-5-12-30/h1-3,6-10,13,21-24,27H,4-5,11-12,14-17H2/t21-,22-,23+,24+/m0/s1 |
| InChIKey | NQJJDWCZFQPMKL-CJRSTVEYSA-N |
| XLogP | 1.76 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |