C16H19N5O4 — CID 162916089
N-[(3R,3aR,6S,6aS)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methoxyacetamide (PubChem CID 162916089) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[(3R,3aR,6S,6aS)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methoxyacetamide.
| Compound Name | N-[(3R,3aR,6S,6aS)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 162916089 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[(3R,3aR,6S,6aS)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@@H]1CO[C@@H]2[C@@H]1OC[C@@H]2n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C16H19N5O4/c1-23-9-13(22)17-11-7-24-15-12(8-25-14(11)15)21-16(18-19-20-21)10-5-3-2-4-6-10/h2-6,11-12,14-15H,7-9H2,1H3,(H,17,22)/t11-,12+,14-,15+/m1/s1 |
| InChIKey | LDBKDUOTXZVTTD-OSRDXIQISA-N |
| XLogP | -0.19 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |