C19H23N6O5- — CID 11879663
4-[[(3S,3aR,6S,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate (PubChem CID 11879663) has the molecular formula C19H23N6O5- and a molecular weight of 415.43 g/mol. Its IUPAC name is 4-[[(3S,3aR,6S,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate.
| Compound Name | 4-[[(3S,3aR,6S,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 11879663 |
| Molecular Formula | C19H23N6O5- |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-[[(3S,3aR,6S,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-4-oxobutanoate |
| SMILES | CN(C)c1ccc(-c2nnnn2[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NC(=O)CCC(=O)[O-])cc1 |
| InChI | InChI=1S/C19H24N6O5/c1-24(2)12-5-3-11(4-6-12)19-21-22-23-25(19)14-10-30-17-13(9-29-18(14)17)20-15(26)7-8-16(27)28/h3-6,13-14,17-18H,7-10H2,1-2H3,(H,20,26)(H,27,28)/p-1/t13-,14-,17+,18+/m0/s1 |
| InChIKey | POXOLLUPUWOYLT-LBTBCDHLSA-M |
| XLogP | -1.24 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |