C25H27F3N6O3 — CID 73138802
1-[6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 73138802) has the molecular formula C25H27F3N6O3 and a molecular weight of 516.52 g/mol. Its IUPAC name is 1-[6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 73138802 |
| Molecular Formula | C25H27F3N6O3 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 1-[6-[4-[[benzyl(methyl)amino]methyl]triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CN(Cc1ccccc1)Cc1cn(C2COC3C(NC(=O)Nc4cccc(C(F)(F)F)c4)COC32)nn1 |
| InChI | InChI=1S/C25H27F3N6O3/c1-33(11-16-6-3-2-4-7-16)12-19-13-34(32-31-19)21-15-37-22-20(14-36-23(21)22)30-24(35)29-18-9-5-8-17(10-18)25(26,27)28/h2-10,13,20-23H,11-12,14-15H2,1H3,(H2,29,30,35) |
| InChIKey | SRRSJCPYONBBHO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |