About cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate
cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 97002361) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 97002361 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C13H19N3O3/c1-8-10(7-14-16-8)12(17)15-11-6-4-3-5-9(11)13(18)19-2/h7,9,11H,3-6H2,1-2H3,(H,14,16)(H,15,17)/t9-,11+/m1/s1 |
| InChIKey | UPUJZICLKJYPOE-KOLCDFICSA-N |
| XLogP | 1.18 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
The IUPAC name of cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate (CID 97002361) is cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate is COC(=O)[C@@H]1CCCC[C@@H]1NC(=O)c1cn[nH]c1C.
What is the InChIKey of cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
The InChIKey is UPUJZICLKJYPOE-KOLCDFICSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-8-10(7-14-16-8)12(17)15-11-6-4-3-5-9(11)13(18)19-2/h7,9,11H,3-6H2,1-2H3,(H,14,16)(H,15,17)/t9-,11+/m1/s1.
What are the key properties of cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate has a molecular weight of 265.31 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1R,2S)-2-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 97002361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).