C13H15ClINO2 — CID 104927151
5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-iodobenzamide (PubChem CID 104927151) has the molecular formula C13H15ClINO2 and a molecular weight of 379.63 g/mol. Its IUPAC name is 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-iodobenzamide.
| Compound Name | 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 104927151 |
| Molecular Formula | C13H15ClINO2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 5-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]-2-iodobenzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C13H15ClINO2/c14-8-5-6-10(15)9(7-8)13(18)16-11-3-1-2-4-12(11)17/h5-7,11-12,17H,1-4H2,(H,16,18)/t11-,12-/m1/s1 |
| InChIKey | IXAKOZDEEPFBIL-VXGBXAGGSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|