C20H15IO5 — CID 132535420
dimethyl 4-hydroxy-2-(2-iodophenyl)naphthalene-1,3-dicarboxylate (PubChem CID 132535420) has the molecular formula C20H15IO5 and a molecular weight of 462.24 g/mol. Its IUPAC name is dimethyl 4-hydroxy-2-(2-iodophenyl)naphthalene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-hydroxy-2-(2-iodophenyl)naphthalene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 132535420 |
| Molecular Formula | C20H15IO5 |
| Molecular Weight | 462.24 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | dimethyl 4-hydroxy-2-(2-iodophenyl)naphthalene-1,3-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2I)c(C(=O)OC)c2ccccc2c1O |
| InChI | InChI=1S/C20H15IO5/c1-25-19(23)16-11-7-3-4-8-12(11)18(22)17(20(24)26-2)15(16)13-9-5-6-10-14(13)21/h3-10,22H,1-2H3 |
| InChIKey | RIMNCKJOMLMAFM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|