C21H13O4- — CID 54721974
3-carboxy-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-olate (PubChem CID 54721974) has the molecular formula C21H13O4- and a molecular weight of 329.33 g/mol. Its IUPAC name is 3-carboxy-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-olate.
| Compound Name | 3-carboxy-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-olate |
|---|---|
| PubChem CID | 54721974 |
| Molecular Formula | C21H13O4- |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-carboxy-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-olate |
| SMILES | O=C(O)c1cc2ccccc2c(-c2c(O)ccc3ccccc23)c1[O-] |
| InChI | InChI=1S/C21H14O4/c22-17-10-9-12-5-1-3-7-14(12)18(17)19-15-8-4-2-6-13(15)11-16(20(19)23)21(24)25/h1-11,22-23H,(H,24,25)/p-1 |
| InChIKey | VMUYFZVUURXESF-UHFFFAOYSA-M |
| XLogP | 4.14 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |