C28H20O3 — CID 18720381
[3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]-(4-methylphenyl)methanone (PubChem CID 18720381) has the molecular formula C28H20O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is [3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 18720381 |
| Molecular Formula | C28H20O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc3ccccc3c(-c3c(O)ccc4ccccc34)c2O)cc1 |
| InChI | InChI=1S/C28H20O3/c1-17-10-12-19(13-11-17)27(30)23-16-20-7-3-5-9-22(20)26(28(23)31)25-21-8-4-2-6-18(21)14-15-24(25)29/h2-16,29,31H,1H3 |
| InChIKey | BEFASPOPOCHXMG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |