C13H12ClN6O5S3- — CID 136598739
1-[5-amino-4-[(5-chloro-6-sulfo-1,3-benzothiazol-2-yl)diazenyl]-3-methylpyrazol-1-yl]ethanesulfinate (PubChem CID 136598739) has the molecular formula C13H12ClN6O5S3- and a molecular weight of 463.93 g/mol. Its IUPAC name is 1-[5-amino-4-[(5-chloro-6-sulfo-1,3-benzothiazol-2-yl)diazenyl]-3-methylpyrazol-1-yl]ethanesulfinate.
| Compound Name | 1-[5-amino-4-[(5-chloro-6-sulfo-1,3-benzothiazol-2-yl)diazenyl]-3-methylpyrazol-1-yl]ethanesulfinate |
|---|---|
| PubChem CID | 136598739 |
| Molecular Formula | C13H12ClN6O5S3- |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | 1-[5-amino-4-[(5-chloro-6-sulfo-1,3-benzothiazol-2-yl)diazenyl]-3-methylpyrazol-1-yl]ethanesulfinate |
| SMILES | Cc1nn(C(C)S(=O)[O-])c(N)c1/N=N/c1nc2cc(Cl)c(S(=O)(=O)O)cc2s1 |
| InChI | InChI=1S/C13H13ClN6O5S3/c1-5-11(12(15)20(19-5)6(2)27(21)22)17-18-13-16-8-3-7(14)10(28(23,24)25)4-9(8)26-13/h3-4,6H,15H2,1-2H3,(H,21,22)(H,23,24,25)/p-1/b18-17+ |
| InChIKey | ZURDYRBBYWFIKT-ISLYRVAYSA-M |
| XLogP | 3.10 |
| TPSA | 175.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|