C22H19N3O2 — CID 159271261
4-(carbonisocyanidoylamino)-N-(3,6,8-trimethylnaphthalen-1-yl)benzamide (PubChem CID 159271261) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-(carbonisocyanidoylamino)-N-(3,6,8-trimethylnaphthalen-1-yl)benzamide.
| Compound Name | 4-(carbonisocyanidoylamino)-N-(3,6,8-trimethylnaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 159271261 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-(carbonisocyanidoylamino)-N-(3,6,8-trimethylnaphthalen-1-yl)benzamide |
| SMILES | [C-]#[N+]C(=O)Nc1ccc(C(=O)Nc2cc(C)cc3cc(C)cc(C)c23)cc1 |
| InChI | InChI=1S/C22H19N3O2/c1-13-9-15(3)20-17(10-13)11-14(2)12-19(20)25-21(26)16-5-7-18(8-6-16)24-22(27)23-4/h5-12H,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | KXTBXBSXHYIOKE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|