C20H17NO4 — CID 71591051
4-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-2-hydroxybenzoic acid (PubChem CID 71591051) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-2-hydroxybenzoic acid.
| Compound Name | 4-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 71591051 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-2-hydroxybenzoic acid |
| SMILES | Cc1cc(C(=O)c2ccccc2)c(C)n1-c1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C20H17NO4/c1-12-10-17(19(23)14-6-4-3-5-7-14)13(2)21(12)15-8-9-16(20(24)25)18(22)11-15/h3-11,22H,1-2H3,(H,24,25) |
| InChIKey | TVPQFFCFVNFKME-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|