C14H14ClNO2 — CID 123317683
2-chloro-5-(2,3,5-trimethylpyrrol-1-yl)benzoic acid (PubChem CID 123317683) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is 2-chloro-5-(2,3,5-trimethylpyrrol-1-yl)benzoic acid.
| Compound Name | 2-chloro-5-(2,3,5-trimethylpyrrol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 123317683 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-chloro-5-(2,3,5-trimethylpyrrol-1-yl)benzoic acid |
| SMILES | Cc1cc(C)n(-c2ccc(Cl)c(C(=O)O)c2)c1C |
| InChI | InChI=1S/C14H14ClNO2/c1-8-6-9(2)16(10(8)3)11-4-5-13(15)12(7-11)14(17)18/h4-7H,1-3H3,(H,17,18) |
| InChIKey | WFTRBBIFGVZPFW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|