C21H27NO3 — CID 54148191
[2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-4-methylpentyl] acetate (PubChem CID 54148191) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is [2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-4-methylpentyl] acetate.
| Compound Name | [2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-4-methylpentyl] acetate |
|---|---|
| PubChem CID | 54148191 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-4-methylpentyl] acetate |
| SMILES | CC(=O)OCC(CC(C)C)n1c(C)cc(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H27NO3/c1-14(2)11-19(13-25-17(5)23)22-15(3)12-20(16(22)4)21(24)18-9-7-6-8-10-18/h6-10,12,14,19H,11,13H2,1-5H3 |
| InChIKey | OFVZEDCZUZHYNB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |