C24H25NO3 — CID 23331771
[2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-1-phenylpropyl] acetate (PubChem CID 23331771) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is [2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-1-phenylpropyl] acetate.
| Compound Name | [2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-1-phenylpropyl] acetate |
|---|---|
| PubChem CID | 23331771 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)-1-phenylpropyl] acetate |
| SMILES | CC(=O)OC(c1ccccc1)C(C)n1c(C)cc(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C24H25NO3/c1-16-15-22(23(27)20-11-7-5-8-12-20)17(2)25(16)18(3)24(28-19(4)26)21-13-9-6-10-14-21/h5-15,18,24H,1-4H3 |
| InChIKey | MRJPWHHUQPLYMZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |