C16H21NO3S — CID 23331800
[1-(1,1-dimethoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-thiophen-2-ylmethanone (PubChem CID 23331800) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is [1-(1,1-dimethoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-thiophen-2-ylmethanone.
| Compound Name | [1-(1,1-dimethoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 23331800 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [1-(1,1-dimethoxypropan-2-yl)-2,5-dimethylpyrrol-3-yl]-thiophen-2-ylmethanone |
| SMILES | COC(OC)C(C)n1c(C)cc(C(=O)c2cccs2)c1C |
| InChI | InChI=1S/C16H21NO3S/c1-10-9-13(15(18)14-7-6-8-21-14)11(2)17(10)12(3)16(19-4)20-5/h6-9,12,16H,1-5H3 |
| InChIKey | CGMKYSOCDYDXEE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|