C14H16ClNOS — CID 43534625
2-chloro-1-[2,5-dimethyl-1-(1-thiophen-2-ylethyl)pyrrol-3-yl]ethanone (PubChem CID 43534625) has the molecular formula C14H16ClNOS and a molecular weight of 281.81 g/mol. Its IUPAC name is 2-chloro-1-[2,5-dimethyl-1-(1-thiophen-2-ylethyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-chloro-1-[2,5-dimethyl-1-(1-thiophen-2-ylethyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 43534625 |
| Molecular Formula | C14H16ClNOS |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-chloro-1-[2,5-dimethyl-1-(1-thiophen-2-ylethyl)pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C(=O)CCl)c(C)n1C(C)c1cccs1 |
| InChI | InChI=1S/C14H16ClNOS/c1-9-7-12(13(17)8-15)10(2)16(9)11(3)14-5-4-6-18-14/h4-7,11H,8H2,1-3H3 |
| InChIKey | XIIRLUUJWARWOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|