C23H23NO3 — CID 23331820
(4-methylphenyl) 2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)propanoate (PubChem CID 23331820) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (4-methylphenyl) 2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)propanoate.
| Compound Name | (4-methylphenyl) 2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 23331820 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (4-methylphenyl) 2-(3-benzoyl-2,5-dimethylpyrrol-1-yl)propanoate |
| SMILES | Cc1ccc(OC(=O)C(C)n2c(C)cc(C(=O)c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-15-10-12-20(13-11-15)27-23(26)18(4)24-16(2)14-21(17(24)3)22(25)19-8-6-5-7-9-19/h5-14,18H,1-4H3 |
| InChIKey | KCVKXCKWYBECGP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|