C20H18O8 — CID 59543954
2,3-bis[(4-methylphenoxy)carbonyl]butanedioic acid (PubChem CID 59543954) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 2,3-bis[(4-methylphenoxy)carbonyl]butanedioic acid.
| Compound Name | 2,3-bis[(4-methylphenoxy)carbonyl]butanedioic acid |
|---|---|
| PubChem CID | 59543954 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2,3-bis[(4-methylphenoxy)carbonyl]butanedioic acid |
| SMILES | Cc1ccc(OC(=O)C(C(=O)O)C(C(=O)O)C(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O8/c1-11-3-7-13(8-4-11)27-19(25)15(17(21)22)16(18(23)24)20(26)28-14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | NQSHFZGUSNQPMN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|