About (4-methylphenoxy)methanethioic S-acid;hydrochloride
(4-methylphenoxy)methanethioic S-acid;hydrochloride (PubChem CID 88842669) has the molecular formula C8H9ClO2S
and a molecular weight of 204.68 g/mol. Its IUPAC name is (4-methylphenoxy)methanethioic S-acid;hydrochloride.
Molecular Properties
| Compound Name | (4-methylphenoxy)methanethioic S-acid;hydrochloride |
| PubChem CID | 88842669 |
| Molecular Formula | C8H9ClO2S |
| Molecular Weight | 204.68 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | (4-methylphenoxy)methanethioic S-acid;hydrochloride |
| SMILES | Cc1ccc(OC(=O)S)cc1.Cl |
| InChI | InChI=1S/C8H8O2S.ClH/c1-6-2-4-7(5-3-6)10-8(9)11;/h2-5H,1H3,(H,9,11);1H |
| InChIKey | YJBACXJZISVVBU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenoxy)methanethioic S-acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenoxy)methanethioic S-acid;hydrochloride?
The IUPAC name of (4-methylphenoxy)methanethioic S-acid;hydrochloride (CID 88842669) is (4-methylphenoxy)methanethioic S-acid;hydrochloride.
What is the SMILES notation for (4-methylphenoxy)methanethioic S-acid;hydrochloride?
The canonical SMILES for (4-methylphenoxy)methanethioic S-acid;hydrochloride is Cc1ccc(OC(=O)S)cc1.Cl.
What is the InChIKey of (4-methylphenoxy)methanethioic S-acid;hydrochloride?
The InChIKey is YJBACXJZISVVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S.ClH/c1-6-2-4-7(5-3-6)10-8(9)11;/h2-5H,1H3,(H,9,11);1H.
What are the key properties of (4-methylphenoxy)methanethioic S-acid;hydrochloride?
(4-methylphenoxy)methanethioic S-acid;hydrochloride has a molecular weight of 204.68 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenoxy)methanethioic S-acid;hydrochloride is sourced from PubChem (CID 88842669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).