C20H11F4NO2 — CID 4027115
N-(2-benzoylphenyl)-2,3,4,5-tetrafluorobenzamide (PubChem CID 4027115) has the molecular formula C20H11F4NO2 and a molecular weight of 373.31 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-(2-benzoylphenyl)-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 4027115 |
| Molecular Formula | C20H11F4NO2 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-(2-benzoylphenyl)-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(c1ccccc1)c1ccccc1NC(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H11F4NO2/c21-14-10-13(16(22)18(24)17(14)23)20(27)25-15-9-5-4-8-12(15)19(26)11-6-2-1-3-7-11/h1-10H,(H,25,27) |
| InChIKey | FRVNBZAJIVPTKX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|