C17H16ClF2NO — CID 4779890
N-(2-butan-2-ylphenyl)-2-chloro-4,5-difluorobenzamide (PubChem CID 4779890) has the molecular formula C17H16ClF2NO and a molecular weight of 323.77 g/mol. Its IUPAC name is N-(2-butan-2-ylphenyl)-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-(2-butan-2-ylphenyl)-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 4779890 |
| Molecular Formula | C17H16ClF2NO |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(2-butan-2-ylphenyl)-2-chloro-4,5-difluorobenzamide |
| SMILES | CCC(C)c1ccccc1NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H16ClF2NO/c1-3-10(2)11-6-4-5-7-16(11)21-17(22)12-8-14(19)15(20)9-13(12)18/h4-10H,3H2,1-2H3,(H,21,22) |
| InChIKey | YCHSQBRGBJPUOB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|