C21H27ClN2O3S — CID 2670785
N-[2-[(2S)-butan-2-yl]phenyl]-2-chloro-5-(diethylsulfamoyl)benzamide (PubChem CID 2670785) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is N-[2-[(2S)-butan-2-yl]phenyl]-2-chloro-5-(diethylsulfamoyl)benzamide.
| Compound Name | N-[2-[(2S)-butan-2-yl]phenyl]-2-chloro-5-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2670785 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[2-[(2S)-butan-2-yl]phenyl]-2-chloro-5-(diethylsulfamoyl)benzamide |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)c1cc(S(=O)(=O)N(CC)CC)ccc1Cl |
| InChI | InChI=1S/C21H27ClN2O3S/c1-5-15(4)17-10-8-9-11-20(17)23-21(25)18-14-16(12-13-19(18)22)28(26,27)24(6-2)7-3/h8-15H,5-7H2,1-4H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | FBXGCMZTFVSOSB-HNNXBMFYSA-N |
| XLogP | 5.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |