C23H19BrClNO2 — CID 3500532
N-(2-benzoyl-4-chlorophenyl)-5-bromo-2,3,4-trimethylbenzamide (PubChem CID 3500532) has the molecular formula C23H19BrClNO2 and a molecular weight of 456.77 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-5-bromo-2,3,4-trimethylbenzamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-5-bromo-2,3,4-trimethylbenzamide |
|---|---|
| PubChem CID | 3500532 |
| Molecular Formula | C23H19BrClNO2 |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-5-bromo-2,3,4-trimethylbenzamide |
| SMILES | Cc1c(Br)cc(C(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C23H19BrClNO2/c1-13-14(2)18(12-20(24)15(13)3)23(28)26-21-10-9-17(25)11-19(21)22(27)16-7-5-4-6-8-16/h4-12H,1-3H3,(H,26,28) |
| InChIKey | JSPSYNOJNDIVHC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |