C17H13Cl2N3O — CID 5348678
2,4-dichloro-N-[5-(4-methylphenyl)-1H-pyrazol-3-yl]benzamide (PubChem CID 5348678) has the molecular formula C17H13Cl2N3O and a molecular weight of 346.22 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-(4-methylphenyl)-1H-pyrazol-3-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-(4-methylphenyl)-1H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 5348678 |
| Molecular Formula | C17H13Cl2N3O |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2,4-dichloro-N-[5-(4-methylphenyl)-1H-pyrazol-3-yl]benzamide |
| SMILES | Cc1ccc(-c2cc(NC(=O)c3ccc(Cl)cc3Cl)n[nH]2)cc1 |
| InChI | InChI=1S/C17H13Cl2N3O/c1-10-2-4-11(5-3-10)15-9-16(22-21-15)20-17(23)13-7-6-12(18)8-14(13)19/h2-9H,1H3,(H2,20,21,22,23) |
| InChIKey | XMRYNIWPNPPDQO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |