C20H15Cl2N5O — CID 2738780
1-(4-chlorophenyl)-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-5-methylpyrazole-4-carboxamide (PubChem CID 2738780) has the molecular formula C20H15Cl2N5O and a molecular weight of 412.28 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2738780 |
| Molecular Formula | C20H15Cl2N5O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[5-(4-chlorophenyl)-1H-pyrazol-3-yl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(-c3ccc(Cl)cc3)[nH]n2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2N5O/c1-12-17(11-23-27(12)16-8-6-15(22)7-9-16)20(28)24-19-10-18(25-26-19)13-2-4-14(21)5-3-13/h2-11H,1H3,(H2,24,25,26,28) |
| InChIKey | JVFXRJSYIBZGTP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |