C19H15ClN4O2 — CID 24629643
1-(4-chlorophenyl)-N-[4-(cyanomethoxy)phenyl]-5-methylpyrazole-4-carboxamide (PubChem CID 24629643) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[4-(cyanomethoxy)phenyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[4-(cyanomethoxy)phenyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24629643 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[4-(cyanomethoxy)phenyl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(OCC#N)cc2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN4O2/c1-13-18(12-22-24(13)16-6-2-14(20)3-7-16)19(25)23-15-4-8-17(9-5-15)26-11-10-21/h2-9,12H,11H2,1H3,(H,23,25) |
| InChIKey | ANNMPRCMUMUANJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |