C20H20BrN3O3 — CID 55658006
1-(4-bromophenyl)-N-[4-(2-methoxyethoxy)phenyl]-5-methylpyrazole-4-carboxamide (PubChem CID 55658006) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[4-(2-methoxyethoxy)phenyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[4-(2-methoxyethoxy)phenyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55658006 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 1-(4-bromophenyl)-N-[4-(2-methoxyethoxy)phenyl]-5-methylpyrazole-4-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2cnn(-c3ccc(Br)cc3)c2C)cc1 |
| InChI | InChI=1S/C20H20BrN3O3/c1-14-19(13-22-24(14)17-7-3-15(21)4-8-17)20(25)23-16-5-9-18(10-6-16)27-12-11-26-2/h3-10,13H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | ZUITZHWCEDYPFI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|