C21H22BrN3O3 — CID 46562409
1-(4-bromophenyl)-N-(3,4-diethoxyphenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 46562409) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(3,4-diethoxyphenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-(3,4-diethoxyphenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46562409 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1-(4-bromophenyl)-N-(3,4-diethoxyphenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cnn(-c3ccc(Br)cc3)c2C)cc1OCC |
| InChI | InChI=1S/C21H22BrN3O3/c1-4-27-19-11-8-16(12-20(19)28-5-2)24-21(26)18-13-23-25(14(18)3)17-9-6-15(22)7-10-17/h6-13H,4-5H2,1-3H3,(H,24,26) |
| InChIKey | LYBXJWLVYGXBGO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |