C23H18BrN5O3 — CID 60616920
1-(4-bromophenyl)-N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-5-methylpyrazole-4-carboxamide (PubChem CID 60616920) has the molecular formula C23H18BrN5O3 and a molecular weight of 492.33 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60616920 |
| Molecular Formula | C23H18BrN5O3 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 1-(4-bromophenyl)-N-[6-(3-carbamoylphenoxy)-3-pyridinyl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(Oc3cccc(C(N)=O)c3)nc2)cnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H18BrN5O3/c1-14-20(13-27-29(14)18-8-5-16(24)6-9-18)23(31)28-17-7-10-21(26-12-17)32-19-4-2-3-15(11-19)22(25)30/h2-13H,1H3,(H2,25,30)(H,28,31) |
| InChIKey | FBWCXJXTQMKORF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |