C23H25ClN4O — CID 157416031
1-(4-chlorophenyl)-N-(6-cyclohexyl-5-methyl-3-pyridinyl)-5-methylpyrazole-4-carboxamide (PubChem CID 157416031) has the molecular formula C23H25ClN4O and a molecular weight of 408.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(6-cyclohexyl-5-methyl-3-pyridinyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(6-cyclohexyl-5-methyl-3-pyridinyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 157416031 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(6-cyclohexyl-5-methyl-3-pyridinyl)-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnn(-c3ccc(Cl)cc3)c2C)cnc1C1CCCCC1 |
| InChI | InChI=1S/C23H25ClN4O/c1-15-12-19(13-25-22(15)17-6-4-3-5-7-17)27-23(29)21-14-26-28(16(21)2)20-10-8-18(24)9-11-20/h8-14,17H,3-7H2,1-2H3,(H,27,29) |
| InChIKey | BOVWUVRGXGULSP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |