C19H11Cl4N3O2 — CID 23828920
2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-pyridinyl]benzamide (PubChem CID 23828920) has the molecular formula C19H11Cl4N3O2 and a molecular weight of 455.13 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-pyridinyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 23828920 |
| Molecular Formula | C19H11Cl4N3O2 |
| Molecular Weight | 455.13 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccncc1NC(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H11Cl4N3O2/c20-10-1-3-12(14(22)7-10)18(27)25-16-5-6-24-9-17(16)26-19(28)13-4-2-11(21)8-15(13)23/h1-9H,(H,26,28)(H,24,25,27) |
| InChIKey | ACFHEZKVGZKLGP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.13 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |