C12H9ClF3N3O — CID 110861901
N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide (PubChem CID 110861901) has the molecular formula C12H9ClF3N3O and a molecular weight of 303.67 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 110861901 |
| Molecular Formula | C12H9ClF3N3O |
| Molecular Weight | 303.67 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H9ClF3N3O/c1-19-6-17-5-10(19)11(20)18-9-4-7(12(14,15)16)2-3-8(9)13/h2-6H,1H3,(H,18,20) |
| InChIKey | JZFHKLDZWLBDAI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |