C13H9F3N4O — CID 103510962
N-[2-cyano-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide (PubChem CID 103510962) has the molecular formula C13H9F3N4O and a molecular weight of 294.24 g/mol. Its IUPAC name is N-[2-cyano-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-[2-cyano-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 103510962 |
| Molecular Formula | C13H9F3N4O |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-[2-cyano-4-(trifluoromethyl)phenyl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)Nc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C13H9F3N4O/c1-20-7-18-6-11(20)12(21)19-10-3-2-9(13(14,15)16)4-8(10)5-17/h2-4,6-7H,1H3,(H,19,21) |
| InChIKey | MNLISUZYPKNFII-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |