C10H8F2N4O — CID 103512452
N-(2,6-difluoro-3-pyridinyl)-3-methylimidazole-4-carboxamide (PubChem CID 103512452) has the molecular formula C10H8F2N4O and a molecular weight of 238.20 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-3-methylimidazole-4-carboxamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 103512452 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cncc1C(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C10H8F2N4O/c1-16-5-13-4-7(16)10(17)14-6-2-3-8(11)15-9(6)12/h2-5H,1H3,(H,14,17) |
| InChIKey | WWLCDNUWHJSXHL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|