C14H11Cl2N3O2 — CID 66484687
3-chloro-N-[2-chloro-5-(methylcarbamoyl)phenyl]pyridine-4-carboxamide (PubChem CID 66484687) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 3-chloro-N-[2-chloro-5-(methylcarbamoyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[2-chloro-5-(methylcarbamoyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 66484687 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 3-chloro-N-[2-chloro-5-(methylcarbamoyl)phenyl]pyridine-4-carboxamide |
| SMILES | CNC(=O)c1ccc(Cl)c(NC(=O)c2ccncc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c1-17-13(20)8-2-3-10(15)12(6-8)19-14(21)9-4-5-18-7-11(9)16/h2-7H,1H3,(H,17,20)(H,19,21) |
| InChIKey | JWEYCOXZKNTEOW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |