C17H17BrCl2NO4PS — CID 102358373
5-bromo-N-(3,4-dichlorophenyl)-2-diethoxyphosphinothioyloxybenzamide (PubChem CID 102358373) has the molecular formula C17H17BrCl2NO4PS and a molecular weight of 513.18 g/mol. Its IUPAC name is 5-bromo-N-(3,4-dichlorophenyl)-2-diethoxyphosphinothioyloxybenzamide.
| Compound Name | 5-bromo-N-(3,4-dichlorophenyl)-2-diethoxyphosphinothioyloxybenzamide |
|---|---|
| PubChem CID | 102358373 |
| Molecular Formula | C17H17BrCl2NO4PS |
| Molecular Weight | 513.18 g/mol |
| Exact Mass | 510.92 |
| IUPAC Name | 5-bromo-N-(3,4-dichlorophenyl)-2-diethoxyphosphinothioyloxybenzamide |
| SMILES | CCOP(=S)(OCC)Oc1ccc(Br)cc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17BrCl2NO4PS/c1-3-23-26(27,24-4-2)25-16-8-5-11(18)9-13(16)17(22)21-12-6-7-14(19)15(20)10-12/h5-10H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | OWGLSDMNZDLIDU-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.18 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|