C20H22Cl2N2O3 — CID 46231642
[4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-hexylcarbamate (PubChem CID 46231642) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is [4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-hexylcarbamate.
| Compound Name | [4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-hexylcarbamate |
|---|---|
| PubChem CID | 46231642 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [4-chloro-2-[(3-chlorophenyl)carbamoyl]phenyl] N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)Oc1ccc(Cl)cc1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-2-3-4-5-11-23-20(26)27-18-10-9-15(22)13-17(18)19(25)24-16-8-6-7-14(21)12-16/h6-10,12-13H,2-5,11H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | FORDENPUNDZVOS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|