C28H37ClFN3O6 — CID 59205025
tert-butyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenyl]-2-ethylpiperazine-1-carboxylate (PubChem CID 59205025) has the molecular formula C28H37ClFN3O6 and a molecular weight of 566.07 g/mol. Its IUPAC name is tert-butyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenyl]-2-ethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenyl]-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 59205025 |
| Molecular Formula | C28H37ClFN3O6 |
| Molecular Weight | 566.07 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | tert-butyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluorophenyl]-2-ethylpiperazine-1-carboxylate |
| SMILES | CCC1CN(c2ccc(NC(=O)c3cc(Cl)ccc3OCOCCOC)cc2F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37ClFN3O6/c1-6-21-17-32(11-12-33(21)27(35)39-28(2,3)4)24-9-8-20(16-23(24)30)31-26(34)22-15-19(29)7-10-25(22)38-18-37-14-13-36-5/h7-10,15-16,21H,6,11-14,17-18H2,1-5H3,(H,31,34) |
| InChIKey | GGGCSBPGFAVEKO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.07 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|