C25H31ClFN3O6 — CID 59205009
ethyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluoroanilino]piperidine-1-carboxylate (PubChem CID 59205009) has the molecular formula C25H31ClFN3O6 and a molecular weight of 523.99 g/mol. Its IUPAC name is ethyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluoroanilino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluoroanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59205009 |
| Molecular Formula | C25H31ClFN3O6 |
| Molecular Weight | 523.99 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | ethyl 4-[4-[[5-chloro-2-(2-methoxyethoxymethoxy)benzoyl]amino]-2-fluoroanilino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(NC(=O)c3cc(Cl)ccc3OCOCCOC)cc2F)CC1 |
| InChI | InChI=1S/C25H31ClFN3O6/c1-3-35-25(32)30-10-8-18(9-11-30)28-22-6-5-19(15-21(22)27)29-24(31)20-14-17(26)4-7-23(20)36-16-34-13-12-33-2/h4-7,14-15,18,28H,3,8-13,16H2,1-2H3,(H,29,31) |
| InChIKey | RWXUYXAPMULIGR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.99 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|