C21H18Cl2N4O3 — CID 78883751
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 78883751) has the molecular formula C21H18Cl2N4O3 and a molecular weight of 445.31 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 78883751 |
| Molecular Formula | C21H18Cl2N4O3 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)Nc1ccc(N2CCNC(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C21H18Cl2N4O3/c1-12-19(20(26-30-12)14-4-2-3-5-15(14)22)21(29)25-13-6-7-17(16(23)10-13)27-9-8-24-18(28)11-27/h2-7,10H,8-9,11H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | UFGZIWXBYSDYBV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|